C39H43FO8 — CID 142281497
[4-[4-[3-fluoro-2-heptyl-4-[4-(trioxidanyl)phenyl]phenyl]phenyl]phenyl] 2-(hydroxymethyl)prop-2-eneperoxoate;2-methylprop-2-en-1-ol (PubChem CID 142281497) has the molecular formula C39H43FO8 and a molecular weight of 658.76 g/mol. Its IUPAC name is [4-[4-[3-fluoro-2-heptyl-4-[4-(trioxidanyl)phenyl]phenyl]phenyl]phenyl] 2-(hydroxymethyl)prop-2-eneperoxoate;2-methylprop-2-en-1-ol.
| Compound Name | [4-[4-[3-fluoro-2-heptyl-4-[4-(trioxidanyl)phenyl]phenyl]phenyl]phenyl] 2-(hydroxymethyl)prop-2-eneperoxoate;2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 142281497 |
| Molecular Formula | C39H43FO8 |
| Molecular Weight | 658.76 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | [4-[4-[3-fluoro-2-heptyl-4-[4-(trioxidanyl)phenyl]phenyl]phenyl]phenyl] 2-(hydroxymethyl)prop-2-eneperoxoate;2-methylprop-2-en-1-ol |
| SMILES | C=C(C)CO.C=C(CO)C(=O)OOc1ccc(-c2ccc(-c3ccc(-c4ccc(OOO)cc4)c(F)c3CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C35H35FO7.C4H8O/c1-3-4-5-6-7-8-33-31(21-22-32(34(33)36)28-15-19-30(20-16-28)41-43-39)27-11-9-25(10-12-27)26-13-17-29(18-14-26)40-42-35(38)24(2)23-37;1-4(2)3-5/h9-22,37,39H,2-8,23H2,1H3;5H,1,3H2,2H3 |
| InChIKey | CNUILXBEJZFTKB-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.76 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|