C24H45NO — CID 142282725
N,N-dimethyl-1-[4-(4-pentylcyclohexyl)cyclohexyl]methanamine;2-methylprop-2-enal (PubChem CID 142282725) has the molecular formula C24H45NO and a molecular weight of 363.63 g/mol. Its IUPAC name is N,N-dimethyl-1-[4-(4-pentylcyclohexyl)cyclohexyl]methanamine;2-methylprop-2-enal.
| Compound Name | N,N-dimethyl-1-[4-(4-pentylcyclohexyl)cyclohexyl]methanamine;2-methylprop-2-enal |
|---|---|
| PubChem CID | 142282725 |
| Molecular Formula | C24H45NO |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.35 |
| IUPAC Name | N,N-dimethyl-1-[4-(4-pentylcyclohexyl)cyclohexyl]methanamine;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CCCCCC1CCC(C2CCC(CN(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H39N.C4H6O/c1-4-5-6-7-17-8-12-19(13-9-17)20-14-10-18(11-15-20)16-21(2)3;1-4(2)3-5/h17-20H,4-16H2,1-3H3;3H,1H2,2H3 |
| InChIKey | HVBJMVHXCCXWMP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|