C22H26N2O2 — CID 142283396
7-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethoxy]quinoline (PubChem CID 142283396) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 7-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethoxy]quinoline.
| Compound Name | 7-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethoxy]quinoline |
|---|---|
| PubChem CID | 142283396 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 7-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidin-1-yl]ethoxy]quinoline |
| SMILES | C=C/C=C(\C=C)OC1CCN(CCOc2ccc3cccnc3c2)CC1 |
| InChI | InChI=1S/C22H26N2O2/c1-3-6-19(4-2)26-20-10-13-24(14-11-20)15-16-25-21-9-8-18-7-5-12-23-22(18)17-21/h3-9,12,17,20H,1-2,10-11,13-16H2/b19-6+ |
| InChIKey | RSHFXXSFNZAOPV-KPSZGOFPSA-N |
| XLogP | 4.35 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|