C28H31N5O3 — CID 142284625
5-[3-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile (PubChem CID 142284625) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 5-[3-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile.
| Compound Name | 5-[3-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 142284625 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 5-[3-[6-[4-(2-hydroxyethyl)piperazin-1-yl]-1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3C3CC3C4N3CCN(CCO)CC3)no2)cc1C#N |
| InChI | InChI=1S/C28H31N5O3/c1-17(2)35-24-7-6-18(14-19(24)16-29)28-30-27(31-36-28)21-5-3-4-20-25(21)22-15-23(22)26(20)33-10-8-32(9-11-33)12-13-34/h3-7,14,17,22-23,26,34H,8-13,15H2,1-2H3 |
| InChIKey | CFSPBGDVGWXCQJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |