C27H31N5O2S — CID 144841118
2-propan-2-yloxy-5-[3-[1-(2-pyrrolidin-1-ylethylsulfanylamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-oxadiazol-5-yl]benzonitrile (PubChem CID 144841118) has the molecular formula C27H31N5O2S and a molecular weight of 489.65 g/mol. Its IUPAC name is 2-propan-2-yloxy-5-[3-[1-(2-pyrrolidin-1-ylethylsulfanylamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-oxadiazol-5-yl]benzonitrile.
| Compound Name | 2-propan-2-yloxy-5-[3-[1-(2-pyrrolidin-1-ylethylsulfanylamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-oxadiazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 144841118 |
| Molecular Formula | C27H31N5O2S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-propan-2-yloxy-5-[3-[1-(2-pyrrolidin-1-ylethylsulfanylamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-oxadiazol-5-yl]benzonitrile |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3CCC4NSCCN3CCCC3)no2)cc1C#N |
| InChI | InChI=1S/C27H31N5O2S/c1-18(2)33-25-11-8-19(16-20(25)17-28)27-29-26(30-34-27)23-7-5-6-22-21(23)9-10-24(22)31-35-15-14-32-12-3-4-13-32/h5-8,11,16,18,24,31H,3-4,9-10,12-15H2,1-2H3 |
| InChIKey | NMZRGOCMLFSEIL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|