C29H39N5O3S — CID 144840991
5-[3-(2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile;methanol;N-(2-pyrrolidin-1-ylethylsulfanyl)methanamine (PubChem CID 144840991) has the molecular formula C29H39N5O3S and a molecular weight of 537.73 g/mol. Its IUPAC name is 5-[3-(2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile;methanol;N-(2-pyrrolidin-1-ylethylsulfanyl)methanamine.
| Compound Name | 5-[3-(2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile;methanol;N-(2-pyrrolidin-1-ylethylsulfanyl)methanamine |
|---|---|
| PubChem CID | 144840991 |
| Molecular Formula | C29H39N5O3S |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | 5-[3-(2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile;methanol;N-(2-pyrrolidin-1-ylethylsulfanyl)methanamine |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3CCC4)no2)cc1C#N.CNSCCN1CCCC1.CO |
| InChI | InChI=1S/C21H19N3O2.C7H16N2S.CH4O/c1-13(2)25-19-10-9-15(11-16(19)12-22)21-23-20(24-26-21)18-8-4-6-14-5-3-7-17(14)18;1-8-10-7-6-9-4-2-3-5-9;1-2/h4,6,8-11,13H,3,5,7H2,1-2H3;8H,2-7H2,1H3;2H,1H3 |
| InChIKey | LICNGNLTCCHRGY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|