C26H27N5O3 — CID 166761231
5-[3-[1-[2-(azetidin-1-yl)ethoxyimino]-2,3-dihydroinden-4-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile (PubChem CID 166761231) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 5-[3-[1-[2-(azetidin-1-yl)ethoxyimino]-2,3-dihydroinden-4-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile.
| Compound Name | 5-[3-[1-[2-(azetidin-1-yl)ethoxyimino]-2,3-dihydroinden-4-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 166761231 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 5-[3-[1-[2-(azetidin-1-yl)ethoxyimino]-2,3-dihydroinden-4-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3CCC4=NOCCN3CCC3)no2)cc1C#N |
| InChI | InChI=1S/C26H27N5O3/c1-17(2)33-24-10-7-18(15-19(24)16-27)26-28-25(30-34-26)22-6-3-5-21-20(22)8-9-23(21)29-32-14-13-31-11-4-12-31/h3,5-7,10,15,17H,4,8-9,11-14H2,1-2H3 |
| InChIKey | GDDFIQUZOFAFJJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 96.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|