C27H31N5O3 — CID 166761227
5-[3-[1-[2-(diethylamino)ethoxyimino]-2,3-dihydroinden-4-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile (PubChem CID 166761227) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is 5-[3-[1-[2-(diethylamino)ethoxyimino]-2,3-dihydroinden-4-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile.
| Compound Name | 5-[3-[1-[2-(diethylamino)ethoxyimino]-2,3-dihydroinden-4-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 166761227 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 5-[3-[1-[2-(diethylamino)ethoxyimino]-2,3-dihydroinden-4-yl]-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
| SMILES | CCN(CC)CCON=C1CCc2c1cccc2-c1noc(-c2ccc(OC(C)C)c(C#N)c2)n1 |
| InChI | InChI=1S/C27H31N5O3/c1-5-32(6-2)14-15-33-30-24-12-11-21-22(24)8-7-9-23(21)26-29-27(35-31-26)19-10-13-25(34-18(3)4)20(16-19)17-28/h7-10,13,16,18H,5-6,11-12,14-15H2,1-4H3 |
| InChIKey | BRIKGFLATYZOOH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 96.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|