C25H24N4O5 — CID 168741989
4-[(Z)-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]amino]oxybutanoic acid (PubChem CID 168741989) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is 4-[(Z)-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]amino]oxybutanoic acid.
| Compound Name | 4-[(Z)-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]amino]oxybutanoic acid |
|---|---|
| PubChem CID | 168741989 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 4-[(Z)-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]amino]oxybutanoic acid |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3cccc4c3CC/C4=N/OCCCC(=O)O)no2)ccc1OC(C)C |
| InChI | InChI=1S/C25H24N4O5/c1-15(2)33-22-12-9-16(14-21(22)26-3)25-27-24(29-34-25)19-7-4-6-18-17(19)10-11-20(18)28-32-13-5-8-23(30)31/h4,6-7,9,12,14-15H,5,8,10-11,13H2,1-2H3,(H,30,31)/b28-20- |
| InChIKey | PFEBABBGJGHBLU-RRAHZORUSA-N |
| XLogP | 5.27 |
| TPSA | 111.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|