C26H27N5O4 — CID 58354967
3-hydroxy-N-[(1S)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]azetidine-1-carboxamide (PubChem CID 58354967) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-hydroxy-N-[(1S)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]azetidine-1-carboxamide.
| Compound Name | 3-hydroxy-N-[(1S)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 58354967 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-hydroxy-N-[(1S)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]azetidine-1-carboxamide |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3cccc4c3CCC[C@@H]4NC(=O)N3CC(O)C3)no2)ccc1OC(C)C |
| InChI | InChI=1S/C26H27N5O4/c1-15(2)34-23-11-10-16(12-22(23)27-3)25-29-24(30-35-25)20-8-4-7-19-18(20)6-5-9-21(19)28-26(33)31-13-17(32)14-31/h4,7-8,10-12,15,17,21,32H,5-6,9,13-14H2,1-2H3,(H,28,33)/t21-/m0/s1 |
| InChIKey | BTYCBRPHZXPBIB-NRFANRHFSA-N |
| XLogP | 4.51 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|