C21H18ClN3O2 — CID 123523193
3-(1-chloro-2,3-dihydro-1H-inden-4-yl)-5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazole (PubChem CID 123523193) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is 3-(1-chloro-2,3-dihydro-1H-inden-4-yl)-5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloro-2,3-dihydro-1H-inden-4-yl)-5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 123523193 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-(1-chloro-2,3-dihydro-1H-inden-4-yl)-5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazole |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3cccc4c3CCC4Cl)no2)ccc1OC(C)C |
| InChI | InChI=1S/C21H18ClN3O2/c1-12(2)26-19-10-7-13(11-18(19)23-3)21-24-20(25-27-21)16-6-4-5-15-14(16)8-9-17(15)22/h4-7,10-12,17H,8-9H2,1-2H3 |
| InChIKey | STVPYYWKRZIDHD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|