C24H26N4O2 — CID 161492867
(1S)-1,2,2-trideuterio-N-(1,1-dideuteriopropyl)-4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3H-inden-1-amine (PubChem CID 161492867) has the molecular formula C24H26N4O2 and a molecular weight of 407.53 g/mol. Its IUPAC name is (1S)-1,2,2-trideuterio-N-(1,1-dideuteriopropyl)-4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3H-inden-1-amine.
| Compound Name | (1S)-1,2,2-trideuterio-N-(1,1-dideuteriopropyl)-4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3H-inden-1-amine |
|---|---|
| PubChem CID | 161492867 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | (1S)-1,2,2-trideuterio-N-(1,1-dideuteriopropyl)-4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3H-inden-1-amine |
| SMILES | [2H]C([2H])(CC)N[C@]1([2H])c2cccc(-c3noc(-c4ccc(OC(C)C)c([N+]#[C-])c4)n3)c2CC1([2H])[2H] |
| InChI | InChI=1S/C24H26N4O2/c1-5-13-26-20-11-10-17-18(20)7-6-8-19(17)23-27-24(30-28-23)16-9-12-22(29-15(2)3)21(14-16)25-4/h6-9,12,14-15,20,26H,5,10-11,13H2,1-3H3/t20-/m0/s1/i11D2,13D2,20D |
| InChIKey | QNAROKWXUYBILJ-YPVIZARLSA-N |
| XLogP | 5.73 |
| TPSA | 64.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|