C21H18N4O3 — CID 168741983
(NZ)-N-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 168741983) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is (NZ)-N-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 168741983 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (NZ)-N-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3cccc4c3CC/C4=N/O)no2)ccc1OC(C)C |
| InChI | InChI=1S/C21H18N4O3/c1-12(2)27-19-10-7-13(11-18(19)22-3)21-23-20(25-28-21)16-6-4-5-15-14(16)8-9-17(15)24-26/h4-7,10-12,26H,8-9H2,1-2H3/b24-17- |
| InChIKey | FTOMGTAFPGHZMH-ULJHMMPZSA-N |
| XLogP | 4.87 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|