C24H22N4O4 — CID 168741986
[(Z)-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]amino] propanoate (PubChem CID 168741986) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is [(Z)-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]amino] propanoate.
| Compound Name | [(Z)-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]amino] propanoate |
|---|---|
| PubChem CID | 168741986 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [(Z)-[4-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroinden-1-ylidene]amino] propanoate |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3cccc4c3CC/C4=N/OC(=O)CC)no2)ccc1OC(C)C |
| InChI | InChI=1S/C24H22N4O4/c1-5-22(29)31-27-19-11-10-16-17(19)7-6-8-18(16)23-26-24(32-28-23)15-9-12-21(30-14(2)3)20(13-15)25-4/h6-9,12-14H,5,10-11H2,1-3H3/b27-19- |
| InChIKey | OCSPCSLKFAPAKJ-DIBXZPPDSA-N |
| XLogP | 5.35 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|