C21H21N5O4S — CID 123815757
5-(3-isocyano-4-propan-2-yloxyphenyl)-3-[(1S)-1-(sulfamoylamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-oxadiazole (PubChem CID 123815757) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is 5-(3-isocyano-4-propan-2-yloxyphenyl)-3-[(1S)-1-(sulfamoylamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-oxadiazole.
| Compound Name | 5-(3-isocyano-4-propan-2-yloxyphenyl)-3-[(1S)-1-(sulfamoylamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 123815757 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 5-(3-isocyano-4-propan-2-yloxyphenyl)-3-[(1S)-1-(sulfamoylamino)-2,3-dihydro-1H-inden-4-yl]-1,2,4-oxadiazole |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3cccc4c3CC[C@@H]4NS(N)(=O)=O)no2)ccc1OC(C)C |
| InChI | InChI=1S/C21H21N5O4S/c1-12(2)29-19-10-7-13(11-18(19)23-3)21-24-20(25-30-21)16-6-4-5-15-14(16)8-9-17(15)26-31(22,27)28/h4-7,10-12,17,26H,8-9H2,1-2H3,(H2,22,27,28)/t17-/m0/s1 |
| InChIKey | IEHOOTBKWYVIGF-KRWDZBQOSA-N |
| XLogP | 3.52 |
| TPSA | 124.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|