C27H37N5O3S — CID 144841027
2-(2-aminosulfanylethylamino)ethanol;5-[3-(2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile;ethane (PubChem CID 144841027) has the molecular formula C27H37N5O3S and a molecular weight of 511.69 g/mol. Its IUPAC name is 2-(2-aminosulfanylethylamino)ethanol;5-[3-(2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile;ethane.
| Compound Name | 2-(2-aminosulfanylethylamino)ethanol;5-[3-(2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile;ethane |
|---|---|
| PubChem CID | 144841027 |
| Molecular Formula | C27H37N5O3S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 2-(2-aminosulfanylethylamino)ethanol;5-[3-(2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile;ethane |
| SMILES | CC.CC(C)Oc1ccc(-c2nc(-c3cccc4c3CCC4)no2)cc1C#N.NSCCNCCO |
| InChI | InChI=1S/C21H19N3O2.C4H12N2OS.C2H6/c1-13(2)25-19-10-9-15(11-16(19)12-22)21-23-20(24-26-21)18-8-4-6-14-5-3-7-17(14)18;5-8-4-2-6-1-3-7;1-2/h4,6,8-11,13H,3,5,7H2,1-2H3;6-7H,1-5H2;1-2H3 |
| InChIKey | AIWNWLSWPOWFJP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|