C25H25BN4O4 — CID 88928133
CID 88928133 (PubChem CID 88928133) has the molecular formula C25H25BN4O4 and a molecular weight of 456.31 g/mol.
| Compound Name | CID 88928133 |
|---|---|
| PubChem CID | 88928133 |
| Molecular Formula | C25H25BN4O4 |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | — |
| SMILES | [B]N(CC(=O)OC)[C@H]1CCCc2c(-c3noc(-c4ccc(OC(C)C)c(C#N)c4)n3)cccc21 |
| InChI | InChI=1S/C25H25BN4O4/c1-15(2)33-22-11-10-16(12-17(22)13-27)25-28-24(29-34-25)20-8-4-7-19-18(20)6-5-9-21(19)30(26)14-23(31)32-3/h4,7-8,10-12,15,21H,5-6,9,14H2,1-3H3/t21-/m0/s1 |
| InChIKey | WZIDPGZDIGBAPE-NRFANRHFSA-N |
| XLogP | 4.00 |
| TPSA | 101.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|