C29H34N4O5 — CID 67320331
tert-butyl N-[(1S)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-(2-hydroxyethyl)carbamate (PubChem CID 67320331) has the molecular formula C29H34N4O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is tert-butyl N-[(1S)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-(2-hydroxyethyl)carbamate.
| Compound Name | tert-butyl N-[(1S)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 67320331 |
| Molecular Formula | C29H34N4O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | tert-butyl N-[(1S)-5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-(2-hydroxyethyl)carbamate |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3CCC[C@@H]4N(CCO)C(=O)OC(C)(C)C)no2)cc1C#N |
| InChI | InChI=1S/C29H34N4O5/c1-18(2)36-25-13-12-19(16-20(25)17-30)27-31-26(32-38-27)23-10-6-9-22-21(23)8-7-11-24(22)33(14-15-34)28(35)37-29(3,4)5/h6,9-10,12-13,16,18,24,34H,7-8,11,14-15H2,1-5H3/t24-/m0/s1 |
| InChIKey | CRZQLSIXOJVCOU-DEOSSOPVSA-N |
| XLogP | 5.67 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |