C15H15F2N4+ — CID 142286119
[2,4-difluoro-3-[2-[2-(propylamino)pyrimidin-5-yl]ethynyl]phenyl]azanium (PubChem CID 142286119) has the molecular formula C15H15F2N4+ and a molecular weight of 289.31 g/mol. Its IUPAC name is [2,4-difluoro-3-[2-[2-(propylamino)pyrimidin-5-yl]ethynyl]phenyl]azanium.
| Compound Name | [2,4-difluoro-3-[2-[2-(propylamino)pyrimidin-5-yl]ethynyl]phenyl]azanium |
|---|---|
| PubChem CID | 142286119 |
| Molecular Formula | C15H15F2N4+ |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [2,4-difluoro-3-[2-[2-(propylamino)pyrimidin-5-yl]ethynyl]phenyl]azanium |
| SMILES | CCCNc1ncc(C#Cc2c(F)ccc([NH3+])c2F)cn1 |
| InChI | InChI=1S/C15H14F2N4/c1-2-7-19-15-20-8-10(9-21-15)3-4-11-12(16)5-6-13(18)14(11)17/h5-6,8-9H,2,7,18H2,1H3,(H,19,20,21)/p+1 |
| InChIKey | QLEXPXLRONMHCR-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|