C17H17F2N4O+ — CID 142286222
[2,4-difluoro-3-[2-[2-(oxolan-2-ylmethylamino)pyrimidin-5-yl]ethynyl]phenyl]azanium (PubChem CID 142286222) has the molecular formula C17H17F2N4O+ and a molecular weight of 331.35 g/mol. Its IUPAC name is [2,4-difluoro-3-[2-[2-(oxolan-2-ylmethylamino)pyrimidin-5-yl]ethynyl]phenyl]azanium.
| Compound Name | [2,4-difluoro-3-[2-[2-(oxolan-2-ylmethylamino)pyrimidin-5-yl]ethynyl]phenyl]azanium |
|---|---|
| PubChem CID | 142286222 |
| Molecular Formula | C17H17F2N4O+ |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [2,4-difluoro-3-[2-[2-(oxolan-2-ylmethylamino)pyrimidin-5-yl]ethynyl]phenyl]azanium |
| SMILES | [NH3+]c1ccc(F)c(C#Cc2cnc(NCC3CCCO3)nc2)c1F |
| InChI | InChI=1S/C17H16F2N4O/c18-14-5-6-15(20)16(19)13(14)4-3-11-8-21-17(22-9-11)23-10-12-2-1-7-24-12/h5-6,8-9,12H,1-2,7,10,20H2,(H,21,22,23)/p+1 |
| InChIKey | XAFZKQFFOPOSTH-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|