C20H17F3O2 — CID 142287095
3,3-difluoro-11-(3-fluoro-5-methylphenoxy)-6,7-dimethyl-5-oxatricyclo[6.3.1.04,12]dodeca-1(11),6,8(12),9-tetraene (PubChem CID 142287095) has the molecular formula C20H17F3O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 3,3-difluoro-11-(3-fluoro-5-methylphenoxy)-6,7-dimethyl-5-oxatricyclo[6.3.1.04,12]dodeca-1(11),6,8(12),9-tetraene.
| Compound Name | 3,3-difluoro-11-(3-fluoro-5-methylphenoxy)-6,7-dimethyl-5-oxatricyclo[6.3.1.04,12]dodeca-1(11),6,8(12),9-tetraene |
|---|---|
| PubChem CID | 142287095 |
| Molecular Formula | C20H17F3O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3,3-difluoro-11-(3-fluoro-5-methylphenoxy)-6,7-dimethyl-5-oxatricyclo[6.3.1.04,12]dodeca-1(11),6,8(12),9-tetraene |
| SMILES | CC1=C(C)c2ccc(Oc3cc(C)cc(F)c3)c3c2C(O1)C(F)(F)C3 |
| InChI | InChI=1S/C20H17F3O2/c1-10-6-13(21)8-14(7-10)25-17-5-4-15-11(2)12(3)24-19-18(15)16(17)9-20(19,22)23/h4-8,19H,9H2,1-3H3 |
| InChIKey | YNGKPWPEWHPWFR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |