C11H22NO3S+ — CID 142287652
3,8-dimethoxy-2,3,4,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-4-ium;ethane;sulfane (PubChem CID 142287652) has the molecular formula C11H22NO3S+ and a molecular weight of 248.37 g/mol. Its IUPAC name is 3,8-dimethoxy-2,3,4,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-4-ium;ethane;sulfane.
| Compound Name | 3,8-dimethoxy-2,3,4,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-4-ium;ethane;sulfane |
|---|---|
| PubChem CID | 142287652 |
| Molecular Formula | C11H22NO3S+ |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3,8-dimethoxy-2,3,4,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-4-ium;ethane;sulfane |
| SMILES | CC.COC1=CC=C[NH+]2C(OC)COC12.S |
| InChI | InChI=1S/C9H13NO3.C2H6.H2S/c1-11-7-4-3-5-10-8(12-2)6-13-9(7)10;1-2;/h3-5,8-9H,6H2,1-2H3;1-2H3;1H2/p+1 |
| InChIKey | GQQBRJHOWCWEIG-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |