C10H17NO2 — CID 173058117
2-ethoxy-3-propoxy-1,2-dihydropyridine (PubChem CID 173058117) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-ethoxy-3-propoxy-1,2-dihydropyridine.
| Compound Name | 2-ethoxy-3-propoxy-1,2-dihydropyridine |
|---|---|
| PubChem CID | 173058117 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-ethoxy-3-propoxy-1,2-dihydropyridine |
| SMILES | CCCOC1=CC=CNC1OCC |
| InChI | InChI=1S/C10H17NO2/c1-3-8-13-9-6-5-7-11-10(9)12-4-2/h5-7,10-11H,3-4,8H2,1-2H3 |
| InChIKey | QRNHTOSCKYKZKA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |