C9H15NO2 — CID 173058141
2-methoxy-3-propoxy-1,2-dihydropyridine (PubChem CID 173058141) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-methoxy-3-propoxy-1,2-dihydropyridine.
| Compound Name | 2-methoxy-3-propoxy-1,2-dihydropyridine |
|---|---|
| PubChem CID | 173058141 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2-methoxy-3-propoxy-1,2-dihydropyridine |
| SMILES | CCCOC1=CC=CNC1OC |
| InChI | InChI=1S/C9H15NO2/c1-3-7-12-8-5-4-6-10-9(8)11-2/h4-6,9-10H,3,7H2,1-2H3 |
| InChIKey | VYICDVBSLMSVLU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |