C8H13NO2 — CID 173058050
3-ethoxy-2-methoxy-1,2-dihydropyridine (PubChem CID 173058050) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-ethoxy-2-methoxy-1,2-dihydropyridine.
| Compound Name | 3-ethoxy-2-methoxy-1,2-dihydropyridine |
|---|---|
| PubChem CID | 173058050 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 3-ethoxy-2-methoxy-1,2-dihydropyridine |
| SMILES | CCOC1=CC=CNC1OC |
| InChI | InChI=1S/C8H13NO2/c1-3-11-7-5-4-6-9-8(7)10-2/h4-6,8-9H,3H2,1-2H3 |
| InChIKey | KRWHQKXHMFMQTQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |