C33H26F2N4O2 — CID 142287854
3-[6-(2-bicyclo[2.2.2]octanylamino)-2-(5,7-difluoro-1H-indol-3-yl)pyrimidin-4-yl]xanthen-9-one (PubChem CID 142287854) has the molecular formula C33H26F2N4O2 and a molecular weight of 548.59 g/mol. Its IUPAC name is 3-[6-(2-bicyclo[2.2.2]octanylamino)-2-(5,7-difluoro-1H-indol-3-yl)pyrimidin-4-yl]xanthen-9-one.
| Compound Name | 3-[6-(2-bicyclo[2.2.2]octanylamino)-2-(5,7-difluoro-1H-indol-3-yl)pyrimidin-4-yl]xanthen-9-one |
|---|---|
| PubChem CID | 142287854 |
| Molecular Formula | C33H26F2N4O2 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 3-[6-(2-bicyclo[2.2.2]octanylamino)-2-(5,7-difluoro-1H-indol-3-yl)pyrimidin-4-yl]xanthen-9-one |
| SMILES | O=c1c2ccccc2oc2cc(-c3cc(NC4CC5CCC4CC5)nc(-c4c[nH]c5c(F)cc(F)cc45)n3)ccc12 |
| InChI | InChI=1S/C33H26F2N4O2/c34-20-13-23-24(16-36-31(23)25(35)14-20)33-38-27(15-30(39-33)37-26-11-17-5-7-18(26)8-6-17)19-9-10-22-29(12-19)41-28-4-2-1-3-21(28)32(22)40/h1-4,9-10,12-18,26,36H,5-8,11H2,(H,37,38,39) |
| InChIKey | BPCDTNGAQRQMGQ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|