C21H20FN5O4 — CID 142287883
(2R,3R)-3-[[5-fluoro-2-(7-nitro-1H-indol-3-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 142287883) has the molecular formula C21H20FN5O4 and a molecular weight of 425.42 g/mol. Its IUPAC name is (2R,3R)-3-[[5-fluoro-2-(7-nitro-1H-indol-3-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | (2R,3R)-3-[[5-fluoro-2-(7-nitro-1H-indol-3-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 142287883 |
| Molecular Formula | C21H20FN5O4 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (2R,3R)-3-[[5-fluoro-2-(7-nitro-1H-indol-3-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C2CCC(CC2)[C@H]1Nc1nc(-c2c[nH]c3c([N+](=O)[O-])cccc23)ncc1F |
| InChI | InChI=1S/C21H20FN5O4/c22-14-9-24-19(13-8-23-18-12(13)2-1-3-15(18)27(30)31)26-20(14)25-17-11-6-4-10(5-7-11)16(17)21(28)29/h1-3,8-11,16-17,23H,4-7H2,(H,28,29)(H,24,25,26)/t10?,11?,16-,17-/m1/s1 |
| InChIKey | WPXNKLUINLMKKB-DVGHBQEVSA-N |
| XLogP | 3.97 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|