C46H51N — CID 142288109
(4Z,5Z)-1,2-bis(ethenyl)-4-ethylidene-3,3,6,6-tetramethyl-5-prop-2-enylidenecyclohexene;ethane;3-methyl-6,9-diphenylcarbazole (PubChem CID 142288109) has the molecular formula C46H51N and a molecular weight of 617.92 g/mol. Its IUPAC name is (4Z,5Z)-1,2-bis(ethenyl)-4-ethylidene-3,3,6,6-tetramethyl-5-prop-2-enylidenecyclohexene;ethane;3-methyl-6,9-diphenylcarbazole.
| Compound Name | (4Z,5Z)-1,2-bis(ethenyl)-4-ethylidene-3,3,6,6-tetramethyl-5-prop-2-enylidenecyclohexene;ethane;3-methyl-6,9-diphenylcarbazole |
|---|---|
| PubChem CID | 142288109 |
| Molecular Formula | C46H51N |
| Molecular Weight | 617.92 g/mol |
| Exact Mass | 617.40 |
| IUPAC Name | (4Z,5Z)-1,2-bis(ethenyl)-4-ethylidene-3,3,6,6-tetramethyl-5-prop-2-enylidenecyclohexene;ethane;3-methyl-6,9-diphenylcarbazole |
| SMILES | C=C/C=C1C(=C/C)\C(C)(C)C(C=C)=C(C=C)C\1(C)C.CC.Cc1ccc2c(c1)c1cc(-c3ccccc3)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C25H19N.C19H26.C2H6/c1-18-12-14-24-22(16-18)23-17-20(19-8-4-2-5-9-19)13-15-25(23)26(24)21-10-6-3-7-11-21;1-9-13-17-16(12-4)18(5,6)14(10-2)15(11-3)19(17,7)8;1-2/h2-17H,1H3;9-13H,1-3H2,4-8H3;1-2H3/b;16-12+,17-13+; |
| InChIKey | ZOVBVOWSJYNBEN-HTDAZUMUSA-N |
| XLogP | 13.57 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.92 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |