C58H43N3O2 — CID 142288448
3-[3-[2-[[(3E)-hexa-1,3,5-trien-3-yl]-(9-phenylcarbazol-2-yl)amino]-9,9-dimethylacridin-10-yl]phenyl]xanthen-9-one (PubChem CID 142288448) has the molecular formula C58H43N3O2 and a molecular weight of 814.00 g/mol. Its IUPAC name is 3-[3-[2-[[(3E)-hexa-1,3,5-trien-3-yl]-(9-phenylcarbazol-2-yl)amino]-9,9-dimethylacridin-10-yl]phenyl]xanthen-9-one.
| Compound Name | 3-[3-[2-[[(3E)-hexa-1,3,5-trien-3-yl]-(9-phenylcarbazol-2-yl)amino]-9,9-dimethylacridin-10-yl]phenyl]xanthen-9-one |
|---|---|
| PubChem CID | 142288448 |
| Molecular Formula | C58H43N3O2 |
| Molecular Weight | 814.00 g/mol |
| Exact Mass | 813.34 |
| IUPAC Name | 3-[3-[2-[[(3E)-hexa-1,3,5-trien-3-yl]-(9-phenylcarbazol-2-yl)amino]-9,9-dimethylacridin-10-yl]phenyl]xanthen-9-one |
| SMILES | C=C/C=C(\C=C)N(c1ccc2c(c1)C(C)(C)c1ccccc1N2c1cccc(-c2ccc3c(=O)c4ccccc4oc3c2)c1)c1ccc2c3ccccc3n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C58H43N3O2/c1-5-17-40(6-2)59(44-29-32-46-45-22-10-13-25-51(45)60(54(46)37-44)41-19-8-7-9-20-41)43-30-33-53-50(36-43)58(3,4)49-24-12-14-26-52(49)61(53)42-21-16-18-38(34-42)39-28-31-48-56(35-39)63-55-27-15-11-23-47(55)57(48)62/h5-37H,1-2H2,3-4H3/b40-17+ |
| InChIKey | KDSYPGKGSWDMPA-ZRUDIRFBSA-N |
| XLogP | 15.21 |
| TPSA | 41.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.00 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|