C49H35N3O3 — CID 142288449
2-[3-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)-7-(N-phenylanilino)phenoxazin-10-yl]xanthen-9-one (PubChem CID 142288449) has the molecular formula C49H35N3O3 and a molecular weight of 713.84 g/mol. Its IUPAC name is 2-[3-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)-7-(N-phenylanilino)phenoxazin-10-yl]xanthen-9-one.
| Compound Name | 2-[3-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)-7-(N-phenylanilino)phenoxazin-10-yl]xanthen-9-one |
|---|---|
| PubChem CID | 142288449 |
| Molecular Formula | C49H35N3O3 |
| Molecular Weight | 713.84 g/mol |
| Exact Mass | 713.27 |
| IUPAC Name | 2-[3-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)-7-(N-phenylanilino)phenoxazin-10-yl]xanthen-9-one |
| SMILES | C=C/C=C(\C=C)N(c1ccccc1)c1ccc2c(c1)Oc1cc(N(c3ccccc3)c3ccccc3)ccc1N2c1ccc2oc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C49H35N3O3/c1-3-16-34(4-2)50(35-17-8-5-9-18-35)39-25-28-43-47(32-39)55-48-33-40(51(36-19-10-6-11-20-36)37-21-12-7-13-22-37)26-29-44(48)52(43)38-27-30-46-42(31-38)49(53)41-23-14-15-24-45(41)54-46/h3-33H,1-2H2/b34-16+ |
| InChIKey | NUIMXKNOFHPBBE-AABVJFSESA-N |
| XLogP | 13.39 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.84 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|