C7H10N2 — CID 142290903
3-ethenyl-2-methyl-1,2-dihydropyrazine (PubChem CID 142290903) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 3-ethenyl-2-methyl-1,2-dihydropyrazine.
| Compound Name | 3-ethenyl-2-methyl-1,2-dihydropyrazine |
|---|---|
| PubChem CID | 142290903 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 3-ethenyl-2-methyl-1,2-dihydropyrazine |
| SMILES | C=CC1=NC=CNC1C |
| InChI | InChI=1S/C7H10N2/c1-3-7-6(2)8-4-5-9-7/h3-6,8H,1H2,2H3 |
| InChIKey | QJRBNNDHDRAJSR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |