C8H15NS — CID 142292464
2,6-dimethyl-6H-1,3-thiazine;ethane (PubChem CID 142292464) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is 2,6-dimethyl-6H-1,3-thiazine;ethane.
| Compound Name | 2,6-dimethyl-6H-1,3-thiazine;ethane |
|---|---|
| PubChem CID | 142292464 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2,6-dimethyl-6H-1,3-thiazine;ethane |
| SMILES | CC.CC1=NC=CC(C)S1 |
| InChI | InChI=1S/C6H9NS.C2H6/c1-5-3-4-7-6(2)8-5;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | WXWQGRXGHMEQIT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |