C11H17NS — CID 130382663
pent-4-enyl N-[(1Z)-buta-1,3-dienyl]ethanimidothioate (PubChem CID 130382663) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is pent-4-enyl N-[(1Z)-buta-1,3-dienyl]ethanimidothioate.
| Compound Name | pent-4-enyl N-[(1Z)-buta-1,3-dienyl]ethanimidothioate |
|---|---|
| PubChem CID | 130382663 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | pent-4-enyl N-[(1Z)-buta-1,3-dienyl]ethanimidothioate |
| SMILES | C=C/C=C\N=C(/C)SCCCC=C |
| InChI | InChI=1S/C11H17NS/c1-4-6-8-10-13-11(3)12-9-7-5-2/h4-5,7,9H,1-2,6,8,10H2,3H3/b9-7-,12-11+ |
| InChIKey | ZPAHUGROYNGWIU-YKMQHTRUSA-N |
| XLogP | 3.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|