About ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate
ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate (PubChem CID 143891713) has the molecular formula C12H21NS
and a molecular weight of 211.37 g/mol. Its IUPAC name is ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate.
Molecular Properties
| Compound Name | ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate |
| PubChem CID | 143891713 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate |
| SMILES | C=C/N=C(/C=C/CCC)SC=C.CC |
| InChI | InChI=1S/C10H15NS.C2H6/c1-4-7-8-9-10(11-5-2)12-6-3;1-2/h5-6,8-9H,2-4,7H2,1H3;1-2H3/b9-8+,11-10-; |
| InChIKey | ASCQYZZLRCNZFG-AZYXJCANSA-N |
| XLogP | 4.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate?
The IUPAC name of ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate (CID 143891713) is ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate.
What is the SMILES notation for ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate?
The canonical SMILES for ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate is C=C/N=C(/C=C/CCC)SC=C.CC.
What is the InChIKey of ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate?
The InChIKey is ASCQYZZLRCNZFG-AZYXJCANSA-N. The full InChI is InChI=1S/C10H15NS.C2H6/c1-4-7-8-9-10(11-5-2)12-6-3;1-2/h5-6,8-9H,2-4,7H2,1H3;1-2H3/b9-8+,11-10-;.
What are the key properties of ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate?
ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate has a molecular weight of 211.37 g/mol, XLogP of 4.79, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethenyl (E)-N-ethenylhex-2-enimidothioate is sourced from PubChem (CID 143891713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).