C9H13NS — CID 143885496
4,4-dimethyl-7-methylsulfanylazepine (PubChem CID 143885496) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is 4,4-dimethyl-7-methylsulfanylazepine.
| Compound Name | 4,4-dimethyl-7-methylsulfanylazepine |
|---|---|
| PubChem CID | 143885496 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 4,4-dimethyl-7-methylsulfanylazepine |
| SMILES | CSC1=NC=CC(C)(C)C=C1 |
| InChI | InChI=1S/C9H13NS/c1-9(2)5-4-8(11-3)10-7-6-9/h4-7H,1-3H3 |
| InChIKey | VRTYZQIRZAEEFU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |