C17H32F4N6O2 — CID 142295369
1-[4-[3-(dimethylamino)propylamino]-5-fluoro-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea (PubChem CID 142295369) has the molecular formula C17H32F4N6O2 and a molecular weight of 428.48 g/mol. Its IUPAC name is 1-[4-[3-(dimethylamino)propylamino]-5-fluoro-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea.
| Compound Name | 1-[4-[3-(dimethylamino)propylamino]-5-fluoro-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea |
|---|---|
| PubChem CID | 142295369 |
| Molecular Formula | C17H32F4N6O2 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1-[4-[3-(dimethylamino)propylamino]-5-fluoro-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)cyclohexyl]urea |
| SMILES | CN(C)CCCNC1NC(NC(=O)NC2CCC(OC(F)(F)F)CC2)NCC1F |
| InChI | InChI=1S/C17H32F4N6O2/c1-27(2)9-3-8-22-14-13(18)10-23-15(25-14)26-16(28)24-11-4-6-12(7-5-11)29-17(19,20)21/h11-15,22-23,25H,3-10H2,1-2H3,(H2,24,26,28) |
| InChIKey | MPWSDJKDFXBWEC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|