C10H27N5S2 — CID 142296417
(2S)-2-amino-2-[[(2R)-2-amino-2-(ethylamino)-3-sulfanylpropyl]amino]-3-(ethylamino)propane-1-thiol (PubChem CID 142296417) has the molecular formula C10H27N5S2 and a molecular weight of 281.49 g/mol. Its IUPAC name is (2S)-2-amino-2-[[(2R)-2-amino-2-(ethylamino)-3-sulfanylpropyl]amino]-3-(ethylamino)propane-1-thiol.
| Compound Name | (2S)-2-amino-2-[[(2R)-2-amino-2-(ethylamino)-3-sulfanylpropyl]amino]-3-(ethylamino)propane-1-thiol |
|---|---|
| PubChem CID | 142296417 |
| Molecular Formula | C10H27N5S2 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | (2S)-2-amino-2-[[(2R)-2-amino-2-(ethylamino)-3-sulfanylpropyl]amino]-3-(ethylamino)propane-1-thiol |
| SMILES | CCNC[C@@](N)(CS)NC[C@](N)(CS)NCC |
| InChI | InChI=1S/C10H27N5S2/c1-3-13-5-9(11,7-16)15-6-10(12,8-17)14-4-2/h13-17H,3-8,11-12H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | NIIBVHWREAPXJF-VHSXEESVSA-N |
| XLogP | -1.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|