C58H46BN4O4 — CID 142296819
CID 142296819 (PubChem CID 142296819) has the molecular formula C58H46BN4O4 and a molecular weight of 873.84 g/mol.
| Compound Name | CID 142296819 |
|---|---|
| PubChem CID | 142296819 |
| Molecular Formula | C58H46BN4O4 |
| Molecular Weight | 873.84 g/mol |
| Exact Mass | 873.36 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(n1)oc1c(-c3ccc(-c4ccccc4-c4cc([B]OC(C)(C)C(C)(C)O)cc(-c5ccccc5-c5ccc(-c6cccc7c6oc6nc(C)ccc67)nc5)c4)cn3)cccc12 |
| InChI | InChI=1S/C58H46BN4O4/c1-34-21-25-47-45-17-11-19-49(53(45)65-55(47)62-34)51-27-23-36(32-60-51)41-13-7-9-15-43(41)38-29-39(31-40(30-38)59-67-58(5,6)57(3,4)64)44-16-10-8-14-42(44)37-24-28-52(61-33-37)50-20-12-18-46-48-26-22-35(2)63-56(48)66-54(46)50/h7-33,64H,1-6H3 |
| InChIKey | KKIBESKSKCCSAY-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.84 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|