C57H37BN4O12 — CID 174044473
CID 174044473 (PubChem CID 174044473) has the molecular formula C57H37BN4O12 and a molecular weight of 980.75 g/mol.
| Compound Name | CID 174044473 |
|---|---|
| PubChem CID | 174044473 |
| Molecular Formula | C57H37BN4O12 |
| Molecular Weight | 980.75 g/mol |
| Exact Mass | 980.25 |
| IUPAC Name | — |
| SMILES | [B]C(O)(c1cc(-c2ccccc2-c2ccc(-c3cccc4c3oc3nc(C)ccc34)nc2)cc(C(O)(O)C(O)(O)c2cnc3c(c2)c(=O)oc2ccccc23)c1)C(O)(O)c1cnc2c(c1)c(=O)oc1ccccc12 |
| InChI | InChI=1S/C57H37BN4O12/c1-29-17-19-39-38-13-8-14-40(50(38)74-51(39)62-29)45-20-18-30(26-59-45)36-9-2-3-10-37(36)31-21-32(54(58,65)55(66,67)34-24-43-48(60-27-34)41-11-4-6-15-46(41)72-52(43)63)23-33(22-31)56(68,69)57(70,71)35-25-44-49(61-28-35)42-12-5-7-16-47(42)73-53(44)64/h2-28,65-71H,1H3 |
| InChIKey | ARJSGQXKYIWONP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 266.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.75 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|