C22H32ClN3O2 — CID 142297366
1-N-[2-(2-butan-2-yl-4-chlorophenyl)-2-methylpropyl]-4-nitrobenzene-1,2-diamine;ethane (PubChem CID 142297366) has the molecular formula C22H32ClN3O2 and a molecular weight of 405.97 g/mol. Its IUPAC name is 1-N-[2-(2-butan-2-yl-4-chlorophenyl)-2-methylpropyl]-4-nitrobenzene-1,2-diamine;ethane.
| Compound Name | 1-N-[2-(2-butan-2-yl-4-chlorophenyl)-2-methylpropyl]-4-nitrobenzene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 142297366 |
| Molecular Formula | C22H32ClN3O2 |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-N-[2-(2-butan-2-yl-4-chlorophenyl)-2-methylpropyl]-4-nitrobenzene-1,2-diamine;ethane |
| SMILES | CC.CCC(C)c1cc(Cl)ccc1C(C)(C)CNc1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C20H26ClN3O2.C2H6/c1-5-13(2)16-10-14(21)6-8-17(16)20(3,4)12-23-19-9-7-15(24(25)26)11-18(19)22;1-2/h6-11,13,23H,5,12,22H2,1-4H3;1-2H3 |
| InChIKey | XKSACVFFJSQBST-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|