About 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one
1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one (PubChem CID 1422983) has the molecular formula C9H11N3O5
and a molecular weight of 241.20 g/mol. Its IUPAC name is 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one |
| PubChem CID | 1422983 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one |
| SMILES | COc1nc(CC(C)=O)nc(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N3O5/c1-5(13)4-6-10-8(16-2)7(12(14)15)9(11-6)17-3/h4H2,1-3H3 |
| InChIKey | PPNKLVXLKPRYIR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 104.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one?
The IUPAC name of 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one (CID 1422983) is 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one.
What is the SMILES notation for 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one?
The canonical SMILES for 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one is COc1nc(CC(C)=O)nc(OC)c1[N+](=O)[O-].
What is the InChIKey of 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one?
The InChIKey is PPNKLVXLKPRYIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O5/c1-5(13)4-6-10-8(16-2)7(12(14)15)9(11-6)17-3/h4H2,1-3H3.
What are the key properties of 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one?
1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one has a molecular weight of 241.20 g/mol, XLogP of 0.53, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethoxy-5-nitropyrimidin-2-yl)propan-2-one is sourced from PubChem (CID 1422983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).