C16H28ClN5O8 — CID 69117566
ethyl 3-aminopropanoate;ethyl 3-[(4,6-dimethoxy-5-nitropyrimidin-2-yl)amino]propanoate;hydrochloride (PubChem CID 69117566) has the molecular formula C16H28ClN5O8 and a molecular weight of 453.88 g/mol. Its IUPAC name is ethyl 3-aminopropanoate;ethyl 3-[(4,6-dimethoxy-5-nitropyrimidin-2-yl)amino]propanoate;hydrochloride.
| Compound Name | ethyl 3-aminopropanoate;ethyl 3-[(4,6-dimethoxy-5-nitropyrimidin-2-yl)amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 69117566 |
| Molecular Formula | C16H28ClN5O8 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | ethyl 3-aminopropanoate;ethyl 3-[(4,6-dimethoxy-5-nitropyrimidin-2-yl)amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)CCN.CCOC(=O)CCNc1nc(OC)c([N+](=O)[O-])c(OC)n1.Cl |
| InChI | InChI=1S/C11H16N4O6.C5H11NO2.ClH/c1-4-21-7(16)5-6-12-11-13-9(19-2)8(15(17)18)10(14-11)20-3;1-2-8-5(7)3-4-6;/h4-6H2,1-3H3,(H,12,13,14);2-4,6H2,1H3;1H |
| InChIKey | YEOPGJMJCRDWIN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|