About (Z)-4,5-dimethyloct-4-ene;ethane;propane
(Z)-4,5-dimethyloct-4-ene;ethane;propane (PubChem CID 142299332) has the molecular formula C19H46
and a molecular weight of 274.58 g/mol. Its IUPAC name is (Z)-4,5-dimethyloct-4-ene;ethane;propane.
Molecular Properties
| Compound Name | (Z)-4,5-dimethyloct-4-ene;ethane;propane |
| PubChem CID | 142299332 |
| Molecular Formula | C19H46 |
| Molecular Weight | 274.58 g/mol |
| Exact Mass | 274.36 |
| IUPAC Name | (Z)-4,5-dimethyloct-4-ene;ethane;propane |
| SMILES | CC.CC.CC.CCC.CCC/C(C)=C(/C)CCC |
| InChI | InChI=1S/C10H20.C3H8.3C2H6/c1-5-7-9(3)10(4)8-6-2;1-3-2;3*1-2/h5-8H2,1-4H3;3H2,1-2H3;3*1-2H3/b10-9-;;;; |
| InChIKey | OWOMTIFJMIZHBY-HKIWRJGFSA-N |
| XLogP | 8.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.58 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4,5-dimethyloct-4-ene;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4,5-dimethyloct-4-ene;ethane;propane?
The IUPAC name of (Z)-4,5-dimethyloct-4-ene;ethane;propane (CID 142299332) is (Z)-4,5-dimethyloct-4-ene;ethane;propane.
What is the SMILES notation for (Z)-4,5-dimethyloct-4-ene;ethane;propane?
The canonical SMILES for (Z)-4,5-dimethyloct-4-ene;ethane;propane is CC.CC.CC.CCC.CCC/C(C)=C(/C)CCC.
What is the InChIKey of (Z)-4,5-dimethyloct-4-ene;ethane;propane?
The InChIKey is OWOMTIFJMIZHBY-HKIWRJGFSA-N. The full InChI is InChI=1S/C10H20.C3H8.3C2H6/c1-5-7-9(3)10(4)8-6-2;1-3-2;3*1-2/h5-8H2,1-4H3;3H2,1-2H3;3*1-2H3/b10-9-;;;;.
What are the key properties of (Z)-4,5-dimethyloct-4-ene;ethane;propane?
(Z)-4,5-dimethyloct-4-ene;ethane;propane has a molecular weight of 274.58 g/mol, XLogP of 8.42, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4,5-dimethyloct-4-ene;ethane;propane is sourced from PubChem (CID 142299332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).