C15H18N4O3 — CID 14230005
3'-methyl-1'-(2-methylpropyl)spiro[imidazolidine-5,4'-quinazoline]-2,2',4-trione (PubChem CID 14230005) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3'-methyl-1'-(2-methylpropyl)spiro[imidazolidine-5,4'-quinazoline]-2,2',4-trione.
| Compound Name | 3'-methyl-1'-(2-methylpropyl)spiro[imidazolidine-5,4'-quinazoline]-2,2',4-trione |
|---|---|
| PubChem CID | 14230005 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3'-methyl-1'-(2-methylpropyl)spiro[imidazolidine-5,4'-quinazoline]-2,2',4-trione |
| SMILES | CC(C)CN1C(=O)N(C)C2(NC(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C15H18N4O3/c1-9(2)8-19-11-7-5-4-6-10(11)15(18(3)14(19)22)12(20)16-13(21)17-15/h4-7,9H,8H2,1-3H3,(H2,16,17,20,21) |
| InChIKey | MEEAGEYPHIGODW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|