C27H21F2N3O3 — CID 14230010
7-[3-(benzylideneamino)pyrrolidin-1-yl]-6-fluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 14230010) has the molecular formula C27H21F2N3O3 and a molecular weight of 473.48 g/mol. Its IUPAC name is 7-[3-(benzylideneamino)pyrrolidin-1-yl]-6-fluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[3-(benzylideneamino)pyrrolidin-1-yl]-6-fluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 14230010 |
| Molecular Formula | C27H21F2N3O3 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 7-[3-(benzylideneamino)pyrrolidin-1-yl]-6-fluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2ccc(F)cc2)c2cc(N3CCC(/N=C/c4ccccc4)C3)c(F)cc2c1=O |
| InChI | InChI=1S/C27H21F2N3O3/c28-18-6-8-20(9-7-18)32-16-22(27(34)35)26(33)21-12-23(29)25(13-24(21)32)31-11-10-19(15-31)30-14-17-4-2-1-3-5-17/h1-9,12-14,16,19H,10-11,15H2,(H,34,35)/b30-14+ |
| InChIKey | CZVVZKDITPBYNT-AMVVHIIESA-N |
| XLogP | 4.66 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|