C22H30N2O2 — CID 142300590
ethane;1-[6-methyl-5-(1-morpholin-4-ylethenyl)-2-prop-1-en-2-ylindolizin-7-yl]ethanone (PubChem CID 142300590) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is ethane;1-[6-methyl-5-(1-morpholin-4-ylethenyl)-2-prop-1-en-2-ylindolizin-7-yl]ethanone.
| Compound Name | ethane;1-[6-methyl-5-(1-morpholin-4-ylethenyl)-2-prop-1-en-2-ylindolizin-7-yl]ethanone |
|---|---|
| PubChem CID | 142300590 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | ethane;1-[6-methyl-5-(1-morpholin-4-ylethenyl)-2-prop-1-en-2-ylindolizin-7-yl]ethanone |
| SMILES | C=C(C)c1cc2cc(C(C)=O)c(C)c(C(=C)N3CCOCC3)n2c1.CC |
| InChI | InChI=1S/C20H24N2O2.C2H6/c1-13(2)17-10-18-11-19(16(5)23)14(3)20(22(18)12-17)15(4)21-6-8-24-9-7-21;1-2/h10-12H,1,4,6-9H2,2-3,5H3;1-2H3 |
| InChIKey | DPYFICAPFRQTLN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |