C15H28N4O4 — CID 142301301
tert-butyl N-[1-[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]-2-butoxypropyl]carbamate (PubChem CID 142301301) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl N-[1-[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]-2-butoxypropyl]carbamate.
| Compound Name | tert-butyl N-[1-[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]-2-butoxypropyl]carbamate |
|---|---|
| PubChem CID | 142301301 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | tert-butyl N-[1-[5-(aminomethyl)-1,3,4-oxadiazol-2-yl]-2-butoxypropyl]carbamate |
| SMILES | CCCCOC(C)C(NC(=O)OC(C)(C)C)c1nnc(CN)o1 |
| InChI | InChI=1S/C15H28N4O4/c1-6-7-8-21-10(2)12(13-19-18-11(9-16)22-13)17-14(20)23-15(3,4)5/h10,12H,6-9,16H2,1-5H3,(H,17,20) |
| InChIKey | GMIMAZJUYOFUIW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|