C18H35NO5 — CID 121462507
[(2S,3R)-2-butoxy-4-methylpentan-3-yl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 121462507) has the molecular formula C18H35NO5 and a molecular weight of 345.48 g/mol. Its IUPAC name is [(2S,3R)-2-butoxy-4-methylpentan-3-yl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [(2S,3R)-2-butoxy-4-methylpentan-3-yl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 121462507 |
| Molecular Formula | C18H35NO5 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | [(2S,3R)-2-butoxy-4-methylpentan-3-yl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCCCO[C@@H](C)[C@H](OC(=O)[C@H](C)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C18H35NO5/c1-9-10-11-22-14(5)15(12(2)3)23-16(20)13(4)19-17(21)24-18(6,7)8/h12-15H,9-11H2,1-8H3,(H,19,21)/t13-,14-,15+/m0/s1 |
| InChIKey | RZLCKANJAOIMTR-SOUVJXGZSA-N |
| XLogP | 3.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|