C24H28ClN3 — CID 142302514
(2E,4Z)-2-(1-chloroethenyl)-3-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)hexa-2,4-dienenitrile (PubChem CID 142302514) has the molecular formula C24H28ClN3 and a molecular weight of 393.96 g/mol. Its IUPAC name is (2E,4Z)-2-(1-chloroethenyl)-3-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)hexa-2,4-dienenitrile.
| Compound Name | (2E,4Z)-2-(1-chloroethenyl)-3-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 142302514 |
| Molecular Formula | C24H28ClN3 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | (2E,4Z)-2-(1-chloroethenyl)-3-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)hexa-2,4-dienenitrile |
| SMILES | C=C(Cl)/C(C#N)=C(\C=C/C)c1[nH]c2ccc(C3CCNCC3)cc2c1C(C)C |
| InChI | InChI=1S/C24H28ClN3/c1-5-6-19(21(14-26)16(4)25)24-23(15(2)3)20-13-18(7-8-22(20)28-24)17-9-11-27-12-10-17/h5-8,13,15,17,27-28H,4,9-12H2,1-3H3/b6-5-,21-19+ |
| InChIKey | IYHWCXGZSHFHKP-LJYPVCGZSA-N |
| XLogP | 6.36 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|