C14H20N2 — CID 142305779
1,4-bis(prop-2-enyl)-2,3,4a,5-tetrahydroquinoxaline (PubChem CID 142305779) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1,4-bis(prop-2-enyl)-2,3,4a,5-tetrahydroquinoxaline.
| Compound Name | 1,4-bis(prop-2-enyl)-2,3,4a,5-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 142305779 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1,4-bis(prop-2-enyl)-2,3,4a,5-tetrahydroquinoxaline |
| SMILES | C=CCN1CCN(CC=C)C2CC=CC=C21 |
| InChI | InChI=1S/C14H20N2/c1-3-9-15-11-12-16(10-4-2)14-8-6-5-7-13(14)15/h3-7,14H,1-2,8-12H2 |
| InChIKey | QNFNMBOQYOODGL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|